ChemNet > CAS > 19404-18-3 5-chloro-3-methylbenzo[b]thiophene
19404-18-3 5-chloro-3-methylbenzo[b]thiophene
| Nama produk |
5-chloro-3-methylbenzo[b]thiophene |
| Nama Inggeris |
5-chloro-3-methylbenzo[b]thiophene; 5-Chloro-3-methylthianaphthene; 5-chloro-3-methyl-1-benzothiophene |
| MF |
C9H7ClS |
| Berat Molekul |
182.6699 |
| InChI |
InChI=1/C9H7ClS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5H,1H3 |
| CAS NO |
19404-18-3 |
| Struktur Molekul |
![19404-18-3 5-chloro-3-methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/130/130437_1.gif)
|
| Kepadatan |
1.293g/cm3 |
| Titik lebur |
32℃ |
| Titik didih |
280.5°C at 760 mmHg |
| Indeks bias |
1.66 |
| Titik nyala |
163.1°C |
| Tekanan wap |
0.00641mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
